C21H23N5O3S — CID 5133312
2-[(7-amino-13,13-dimethyl-12-oxa-2,4,6-triazatricyclo[8.4.0.03,8]tetradeca-1,3,5,7,9-pentaen-5-yl)sulfanyl]-N-(4-methoxyphenyl)acetamide (PubChem CID 5133312) has the molecular formula C21H23N5O3S and a molecular weight of 425.51 g/mol. Its IUPAC name is 2-[(7-amino-13,13-dimethyl-12-oxa-2,4,6-triazatricyclo[8.4.0.03,8]tetradeca-1,3,5,7,9-pentaen-5-yl)sulfanyl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[(7-amino-13,13-dimethyl-12-oxa-2,4,6-triazatricyclo[8.4.0.03,8]tetradeca-1,3,5,7,9-pentaen-5-yl)sulfanyl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 5133312 |
| Molecular Formula | C21H23N5O3S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 2-[(7-amino-13,13-dimethyl-12-oxa-2,4,6-triazatricyclo[8.4.0.03,8]tetradeca-1,3,5,7,9-pentaen-5-yl)sulfanyl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CSc2nc(N)c3cc4c(nc3n2)CC(C)(C)OC4)cc1 |
| InChI | InChI=1S/C21H23N5O3S/c1-21(2)9-16-12(10-29-21)8-15-18(22)25-20(26-19(15)24-16)30-11-17(27)23-13-4-6-14(28-3)7-5-13/h4-8H,9-11H2,1-3H3,(H,23,27)(H2,22,24,25,26) |
| InChIKey | USDAWEOPHKDCTQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |