C16H15N5O3S — CID 51334673
N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-5-methylsulfanyl-2-nitrobenzamide (PubChem CID 51334673) has the molecular formula C16H15N5O3S and a molecular weight of 357.40 g/mol. Its IUPAC name is N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-5-methylsulfanyl-2-nitrobenzamide.
| Compound Name | N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-5-methylsulfanyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 51334673 |
| Molecular Formula | C16H15N5O3S |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | N-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-5-methylsulfanyl-2-nitrobenzamide |
| SMILES | CSc1ccc([N+](=O)[O-])c(C(=O)Nc2cnc3c(c2)c(C)nn3C)c1 |
| InChI | InChI=1S/C16H15N5O3S/c1-9-12-6-10(8-17-15(12)20(2)19-9)18-16(22)13-7-11(25-3)4-5-14(13)21(23)24/h4-8H,1-3H3,(H,18,22) |
| InChIKey | IRSGYHWSMDAGES-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|