C20H25N3O — CID 51336206
1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-(1-phenylpyrazol-4-yl)ethanone (PubChem CID 51336206) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-(1-phenylpyrazol-4-yl)ethanone.
| Compound Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-(1-phenylpyrazol-4-yl)ethanone |
|---|---|
| PubChem CID | 51336206 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-(1-phenylpyrazol-4-yl)ethanone |
| SMILES | O=C(Cc1cnn(-c2ccccc2)c1)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C20H25N3O/c24-20(22-12-6-8-17-7-4-5-11-19(17)22)13-16-14-21-23(15-16)18-9-2-1-3-10-18/h1-3,9-10,14-15,17,19H,4-8,11-13H2 |
| InChIKey | WKYHVHGJEAGJJP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |