C18H17N3O3S — CID 51336701
N-(6-acetamido-1,3-benzothiazol-2-yl)-2-(2-methoxyphenyl)acetamide (PubChem CID 51336701) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is N-(6-acetamido-1,3-benzothiazol-2-yl)-2-(2-methoxyphenyl)acetamide.
| Compound Name | N-(6-acetamido-1,3-benzothiazol-2-yl)-2-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 51336701 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | N-(6-acetamido-1,3-benzothiazol-2-yl)-2-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1CC(=O)Nc1nc2ccc(NC(C)=O)cc2s1 |
| InChI | InChI=1S/C18H17N3O3S/c1-11(22)19-13-7-8-14-16(10-13)25-18(20-14)21-17(23)9-12-5-3-4-6-15(12)24-2/h3-8,10H,9H2,1-2H3,(H,19,22)(H,20,21,23) |
| InChIKey | LNGKOSQSTFTPMX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |