About N-methoxy-N,4-dimethylbenzamide
N-methoxy-N,4-dimethylbenzamide (PubChem CID 5133773) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is N-methoxy-N,4-dimethylbenzamide.
Molecular Properties
| Compound Name | N-methoxy-N,4-dimethylbenzamide |
| PubChem CID | 5133773 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | N-methoxy-N,4-dimethylbenzamide |
| SMILES | CON(C)C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C10H13NO2/c1-8-4-6-9(7-5-8)10(12)11(2)13-3/h4-7H,1-3H3 |
| InChIKey | JFLVXYRFUSRSCR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-N,4-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-N,4-dimethylbenzamide?
The IUPAC name of N-methoxy-N,4-dimethylbenzamide (CID 5133773) is N-methoxy-N,4-dimethylbenzamide.
What is the SMILES notation for N-methoxy-N,4-dimethylbenzamide?
The canonical SMILES for N-methoxy-N,4-dimethylbenzamide is CON(C)C(=O)c1ccc(C)cc1.
What is the InChIKey of N-methoxy-N,4-dimethylbenzamide?
The InChIKey is JFLVXYRFUSRSCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-8-4-6-9(7-5-8)10(12)11(2)13-3/h4-7H,1-3H3.
What are the key properties of N-methoxy-N,4-dimethylbenzamide?
N-methoxy-N,4-dimethylbenzamide has a molecular weight of 179.22 g/mol, XLogP of 1.63, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-N,4-dimethylbenzamide is sourced from PubChem (CID 5133773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).