C31H38N2O5S — CID 513407
(2S)-6-[(2,2-diphenylacetyl)amino]-2-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]hexanoic acid (PubChem CID 513407) has the molecular formula C31H38N2O5S and a molecular weight of 550.72 g/mol. Its IUPAC name is (2S)-6-[(2,2-diphenylacetyl)amino]-2-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]hexanoic acid.
| Compound Name | (2S)-6-[(2,2-diphenylacetyl)amino]-2-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 513407 |
| Molecular Formula | C31H38N2O5S |
| Molecular Weight | 550.72 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | (2S)-6-[(2,2-diphenylacetyl)amino]-2-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]hexanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(C)C)[C@@H](CCCCNC(=O)C(c2ccccc2)c2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C31H38N2O5S/c1-23(2)22-33(39(37,38)27-19-17-24(3)18-20-27)28(31(35)36)16-10-11-21-32-30(34)29(25-12-6-4-7-13-25)26-14-8-5-9-15-26/h4-9,12-15,17-20,23,28-29H,10-11,16,21-22H2,1-3H3,(H,32,34)(H,35,36)/t28-/m0/s1 |
| InChIKey | MBGZGGPCRBOQQG-NDEPHWFRSA-N |
| XLogP | 5.21 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.72 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|