C8H20O4S4 — CID 51341375
(2R,3R)-1,4-bis(sulfanyl)butane-2,3-diol;(2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol (PubChem CID 51341375) has the molecular formula C8H20O4S4 and a molecular weight of 308.51 g/mol. Its IUPAC name is (2R,3R)-1,4-bis(sulfanyl)butane-2,3-diol;(2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol.
| Compound Name | (2R,3R)-1,4-bis(sulfanyl)butane-2,3-diol;(2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol |
|---|---|
| PubChem CID | 51341375 |
| Molecular Formula | C8H20O4S4 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | (2R,3R)-1,4-bis(sulfanyl)butane-2,3-diol;(2S,3S)-1,4-bis(sulfanyl)butane-2,3-diol |
| SMILES | O[C@@H](CS)[C@@H](O)CS.O[C@H](CS)[C@H](O)CS |
| InChI | InChI=1S/2C4H10O2S2/c2*5-3(1-7)4(6)2-8/h2*3-8H,1-2H2/t2*3-,4-/m10/s1 |
| InChIKey | DCRJBUYBNCQKEE-CKQOXSRLSA-N |
| XLogP | -0.86 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|