About [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 4-hydroxybenzoate
[2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 4-hydroxybenzoate (PubChem CID 5134139) has the molecular formula C19H26O5
and a molecular weight of 334.41 g/mol. Its IUPAC name is [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 4-hydroxybenzoate.
Molecular Properties
| Compound Name | [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 4-hydroxybenzoate |
| PubChem CID | 5134139 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 4-hydroxybenzoate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)COC(=O)c2ccc(O)cc2)C1 |
| InChI | InChI=1S/C19H26O5/c1-12(2)16-9-4-13(3)10-17(16)24-18(21)11-23-19(22)14-5-7-15(20)8-6-14/h5-8,12-13,16-17,20H,4,9-11H2,1-3H3 |
| InChIKey | ZAGWDQBPYVNQDV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 4-hydroxybenzoate?
The IUPAC name of [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 4-hydroxybenzoate (CID 5134139) is [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 4-hydroxybenzoate.
What is the SMILES notation for [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 4-hydroxybenzoate?
The canonical SMILES for [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 4-hydroxybenzoate is CC1CCC(C(C)C)C(OC(=O)COC(=O)c2ccc(O)cc2)C1.
What is the InChIKey of [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 4-hydroxybenzoate?
The InChIKey is ZAGWDQBPYVNQDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26O5/c1-12(2)16-9-4-13(3)10-17(16)24-18(21)11-23-19(22)14-5-7-15(20)8-6-14/h5-8,12-13,16-17,20H,4,9-11H2,1-3H3.
What are the key properties of [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 4-hydroxybenzoate?
[2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 4-hydroxybenzoate has a molecular weight of 334.41 g/mol, XLogP of 3.55, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 4-hydroxybenzoate is sourced from PubChem (CID 5134139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).