C33H46N4O6S — CID 513421
N-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-2-[N-[(2,3-dimethoxyphenyl)methyl]anilino]acetamide (PubChem CID 513421) has the molecular formula C33H46N4O6S and a molecular weight of 626.82 g/mol. Its IUPAC name is N-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-2-[N-[(2,3-dimethoxyphenyl)methyl]anilino]acetamide.
| Compound Name | N-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-2-[N-[(2,3-dimethoxyphenyl)methyl]anilino]acetamide |
|---|---|
| PubChem CID | 513421 |
| Molecular Formula | C33H46N4O6S |
| Molecular Weight | 626.82 g/mol |
| Exact Mass | 626.31 |
| IUPAC Name | N-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-2-[N-[(2,3-dimethoxyphenyl)methyl]anilino]acetamide |
| SMILES | COc1cccc(CN(CC(=O)NCCCC[C@@H](CO)N(CC(C)C)S(=O)(=O)c2ccc(N)cc2)c2ccccc2)c1OC |
| InChI | InChI=1S/C33H46N4O6S/c1-25(2)21-37(44(40,41)30-18-16-27(34)17-19-30)29(24-38)14-8-9-20-35-32(39)23-36(28-12-6-5-7-13-28)22-26-11-10-15-31(42-3)33(26)43-4/h5-7,10-13,15-19,25,29,38H,8-9,14,20-24,34H2,1-4H3,(H,35,39)/t29-/m0/s1 |
| InChIKey | BTVVAWAWQSVPJK-LJAQVGFWSA-N |
| XLogP | 4.29 |
| TPSA | 134.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.82 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|