About 1-(2,2-diethoxyethyl)-3,4,5-trimethylpyrazole
1-(2,2-diethoxyethyl)-3,4,5-trimethylpyrazole (PubChem CID 51342212) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-3,4,5-trimethylpyrazole.
Molecular Properties
| Compound Name | 1-(2,2-diethoxyethyl)-3,4,5-trimethylpyrazole |
| PubChem CID | 51342212 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-3,4,5-trimethylpyrazole |
| SMILES | CCOC(Cn1nc(C)c(C)c1C)OCC |
| InChI | InChI=1S/C12H22N2O2/c1-6-15-12(16-7-2)8-14-11(5)9(3)10(4)13-14/h12H,6-8H2,1-5H3 |
| InChIKey | YBUAIBQVUDNKEF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-diethoxyethyl)-3,4,5-trimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-diethoxyethyl)-3,4,5-trimethylpyrazole?
The IUPAC name of 1-(2,2-diethoxyethyl)-3,4,5-trimethylpyrazole (CID 51342212) is 1-(2,2-diethoxyethyl)-3,4,5-trimethylpyrazole.
What is the SMILES notation for 1-(2,2-diethoxyethyl)-3,4,5-trimethylpyrazole?
The canonical SMILES for 1-(2,2-diethoxyethyl)-3,4,5-trimethylpyrazole is CCOC(Cn1nc(C)c(C)c1C)OCC.
What is the InChIKey of 1-(2,2-diethoxyethyl)-3,4,5-trimethylpyrazole?
The InChIKey is YBUAIBQVUDNKEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O2/c1-6-15-12(16-7-2)8-14-11(5)9(3)10(4)13-14/h12H,6-8H2,1-5H3.
What are the key properties of 1-(2,2-diethoxyethyl)-3,4,5-trimethylpyrazole?
1-(2,2-diethoxyethyl)-3,4,5-trimethylpyrazole has a molecular weight of 226.32 g/mol, XLogP of 2.21, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-diethoxyethyl)-3,4,5-trimethylpyrazole is sourced from PubChem (CID 51342212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).