About 4-bromo-1-(2,2-diethoxyethyl)-3,5-dimethylpyrazole
4-bromo-1-(2,2-diethoxyethyl)-3,5-dimethylpyrazole (PubChem CID 51342215) has the molecular formula C11H19BrN2O2
and a molecular weight of 291.19 g/mol. Its IUPAC name is 4-bromo-1-(2,2-diethoxyethyl)-3,5-dimethylpyrazole.
Molecular Properties
| Compound Name | 4-bromo-1-(2,2-diethoxyethyl)-3,5-dimethylpyrazole |
| PubChem CID | 51342215 |
| Molecular Formula | C11H19BrN2O2 |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 4-bromo-1-(2,2-diethoxyethyl)-3,5-dimethylpyrazole |
| SMILES | CCOC(Cn1nc(C)c(Br)c1C)OCC |
| InChI | InChI=1S/C11H19BrN2O2/c1-5-15-10(16-6-2)7-14-9(4)11(12)8(3)13-14/h10H,5-7H2,1-4H3 |
| InChIKey | IKYOWYAQODKQAL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-1-(2,2-diethoxyethyl)-3,5-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1-(2,2-diethoxyethyl)-3,5-dimethylpyrazole?
The IUPAC name of 4-bromo-1-(2,2-diethoxyethyl)-3,5-dimethylpyrazole (CID 51342215) is 4-bromo-1-(2,2-diethoxyethyl)-3,5-dimethylpyrazole.
What is the SMILES notation for 4-bromo-1-(2,2-diethoxyethyl)-3,5-dimethylpyrazole?
The canonical SMILES for 4-bromo-1-(2,2-diethoxyethyl)-3,5-dimethylpyrazole is CCOC(Cn1nc(C)c(Br)c1C)OCC.
What is the InChIKey of 4-bromo-1-(2,2-diethoxyethyl)-3,5-dimethylpyrazole?
The InChIKey is IKYOWYAQODKQAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19BrN2O2/c1-5-15-10(16-6-2)7-14-9(4)11(12)8(3)13-14/h10H,5-7H2,1-4H3.
What are the key properties of 4-bromo-1-(2,2-diethoxyethyl)-3,5-dimethylpyrazole?
4-bromo-1-(2,2-diethoxyethyl)-3,5-dimethylpyrazole has a molecular weight of 291.19 g/mol, XLogP of 2.66, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1-(2,2-diethoxyethyl)-3,5-dimethylpyrazole is sourced from PubChem (CID 51342215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).