About N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)undec-10-enehydrazide
N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)undec-10-enehydrazide (PubChem CID 5134273) has the molecular formula C19H32N2O2
and a molecular weight of 320.48 g/mol. Its IUPAC name is N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)undec-10-enehydrazide.
Molecular Properties
| Compound Name | N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)undec-10-enehydrazide |
| PubChem CID | 5134273 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)undec-10-enehydrazide |
| SMILES | C=CCCCCCCCCC(=O)NNC1=CC(=O)CC(C)(C)C1 |
| InChI | InChI=1S/C19H32N2O2/c1-4-5-6-7-8-9-10-11-12-18(23)21-20-16-13-17(22)15-19(2,3)14-16/h4,13,20H,1,5-12,14-15H2,2-3H3,(H,21,23) |
| InChIKey | SPPYNYZUSYMNPW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)undec-10-enehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)undec-10-enehydrazide?
The IUPAC name of N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)undec-10-enehydrazide (CID 5134273) is N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)undec-10-enehydrazide.
What is the SMILES notation for N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)undec-10-enehydrazide?
The canonical SMILES for N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)undec-10-enehydrazide is C=CCCCCCCCCC(=O)NNC1=CC(=O)CC(C)(C)C1.
What is the InChIKey of N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)undec-10-enehydrazide?
The InChIKey is SPPYNYZUSYMNPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32N2O2/c1-4-5-6-7-8-9-10-11-12-18(23)21-20-16-13-17(22)15-19(2,3)14-16/h4,13,20H,1,5-12,14-15H2,2-3H3,(H,21,23).
What are the key properties of N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)undec-10-enehydrazide?
N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)undec-10-enehydrazide has a molecular weight of 320.48 g/mol, XLogP of 4.19, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)undec-10-enehydrazide is sourced from PubChem (CID 5134273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).