C22H20BrClN2O4S — CID 51344163
2-(4-bromo-N-(4-methylphenyl)sulfonylanilino)-N-(3-chloro-4-methoxyphenyl)acetamide (PubChem CID 51344163) has the molecular formula C22H20BrClN2O4S and a molecular weight of 523.84 g/mol. Its IUPAC name is 2-(4-bromo-N-(4-methylphenyl)sulfonylanilino)-N-(3-chloro-4-methoxyphenyl)acetamide.
| Compound Name | 2-(4-bromo-N-(4-methylphenyl)sulfonylanilino)-N-(3-chloro-4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 51344163 |
| Molecular Formula | C22H20BrClN2O4S |
| Molecular Weight | 523.84 g/mol |
| Exact Mass | 522.00 |
| IUPAC Name | 2-(4-bromo-N-(4-methylphenyl)sulfonylanilino)-N-(3-chloro-4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CN(c2ccc(Br)cc2)S(=O)(=O)c2ccc(C)cc2)cc1Cl |
| InChI | InChI=1S/C22H20BrClN2O4S/c1-15-3-10-19(11-4-15)31(28,29)26(18-8-5-16(23)6-9-18)14-22(27)25-17-7-12-21(30-2)20(24)13-17/h3-13H,14H2,1-2H3,(H,25,27) |
| InChIKey | BDQXFNCWVXQCSZ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.84 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |