C26H24N2O3S — CID 51345227
2-[N-(benzenesulfonyl)-3,5-dimethylanilino]-N-naphthalen-2-ylacetamide (PubChem CID 51345227) has the molecular formula C26H24N2O3S and a molecular weight of 444.56 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3,5-dimethylanilino]-N-naphthalen-2-ylacetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3,5-dimethylanilino]-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 51345227 |
| Molecular Formula | C26H24N2O3S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3,5-dimethylanilino]-N-naphthalen-2-ylacetamide |
| SMILES | Cc1cc(C)cc(N(CC(=O)Nc2ccc3ccccc3c2)S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C26H24N2O3S/c1-19-14-20(2)16-24(15-19)28(32(30,31)25-10-4-3-5-11-25)18-26(29)27-23-13-12-21-8-6-7-9-22(21)17-23/h3-17H,18H2,1-2H3,(H,27,29) |
| InChIKey | ZZSQKKFVWPITAE-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |