C20H20ClNO5S2 — CID 51346777
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[(5-thiophen-3-yl-1,3-thiazol-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 51346777) has the molecular formula C20H20ClNO5S2 and a molecular weight of 453.97 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(5-thiophen-3-yl-1,3-thiazol-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(5-thiophen-3-yl-1,3-thiazol-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 51346777 |
| Molecular Formula | C20H20ClNO5S2 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(5-thiophen-3-yl-1,3-thiazol-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ncc(-c4ccsc4)s3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H20ClNO5S2/c21-13-2-1-10(20-19(26)18(25)17(24)14(8-23)27-20)5-12(13)6-16-22-7-15(29-16)11-3-4-28-9-11/h1-5,7,9,14,17-20,23-26H,6,8H2/t14-,17-,18+,19-,20+/m1/s1 |
| InChIKey | FSUWZLJXJGMCFM-QSWMPLQWSA-N |
| XLogP | 2.63 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |