C17H13NO — CID 51346799
6-(2-phenylethynyl)-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 51346799) has the molecular formula C17H13NO and a molecular weight of 247.30 g/mol. Its IUPAC name is 6-(2-phenylethynyl)-3,4-dihydro-2H-isoquinolin-1-one.
| Compound Name | 6-(2-phenylethynyl)-3,4-dihydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 51346799 |
| Molecular Formula | C17H13NO |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 6-(2-phenylethynyl)-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | O=C1NCCc2cc(C#Cc3ccccc3)ccc21 |
| InChI | InChI=1S/C17H13NO/c19-17-16-9-8-14(12-15(16)10-11-18-17)7-6-13-4-2-1-3-5-13/h1-5,8-9,12H,10-11H2,(H,18,19) |
| InChIKey | BOVJHNHRQNCDEQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|