About 1-[1-(3,4-dichlorophenyl)cyclohexyl]-N-methylmethanamine;hydrochloride
1-[1-(3,4-dichlorophenyl)cyclohexyl]-N-methylmethanamine;hydrochloride (PubChem CID 51346817) has the molecular formula C14H20Cl3N
and a molecular weight of 308.68 g/mol. Its IUPAC name is 1-[1-(3,4-dichlorophenyl)cyclohexyl]-N-methylmethanamine;hydrochloride.
Molecular Properties
| Compound Name | 1-[1-(3,4-dichlorophenyl)cyclohexyl]-N-methylmethanamine;hydrochloride |
| PubChem CID | 51346817 |
| Molecular Formula | C14H20Cl3N |
| Molecular Weight | 308.68 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 1-[1-(3,4-dichlorophenyl)cyclohexyl]-N-methylmethanamine;hydrochloride |
| SMILES | CNCC1(c2ccc(Cl)c(Cl)c2)CCCCC1.Cl |
| InChI | InChI=1S/C14H19Cl2N.ClH/c1-17-10-14(7-3-2-4-8-14)11-5-6-12(15)13(16)9-11;/h5-6,9,17H,2-4,7-8,10H2,1H3;1H |
| InChIKey | NVDCJFKPLMLZSU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.68 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[1-(3,4-dichlorophenyl)cyclohexyl]-N-methylmethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(3,4-dichlorophenyl)cyclohexyl]-N-methylmethanamine;hydrochloride?
The IUPAC name of 1-[1-(3,4-dichlorophenyl)cyclohexyl]-N-methylmethanamine;hydrochloride (CID 51346817) is 1-[1-(3,4-dichlorophenyl)cyclohexyl]-N-methylmethanamine;hydrochloride.
What is the SMILES notation for 1-[1-(3,4-dichlorophenyl)cyclohexyl]-N-methylmethanamine;hydrochloride?
The canonical SMILES for 1-[1-(3,4-dichlorophenyl)cyclohexyl]-N-methylmethanamine;hydrochloride is CNCC1(c2ccc(Cl)c(Cl)c2)CCCCC1.Cl.
What is the InChIKey of 1-[1-(3,4-dichlorophenyl)cyclohexyl]-N-methylmethanamine;hydrochloride?
The InChIKey is NVDCJFKPLMLZSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19Cl2N.ClH/c1-17-10-14(7-3-2-4-8-14)11-5-6-12(15)13(16)9-11;/h5-6,9,17H,2-4,7-8,10H2,1H3;1H.
What are the key properties of 1-[1-(3,4-dichlorophenyl)cyclohexyl]-N-methylmethanamine;hydrochloride?
1-[1-(3,4-dichlorophenyl)cyclohexyl]-N-methylmethanamine;hydrochloride has a molecular weight of 308.68 g/mol, XLogP of 4.84, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(3,4-dichlorophenyl)cyclohexyl]-N-methylmethanamine;hydrochloride is sourced from PubChem (CID 51346817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).