C21H22N4O3 — CID 51346932
6-[(2S)-2-(2-methoxyphenyl)morpholin-4-yl]-1-methyl-4-pyrimidin-4-ylpyridin-2-one (PubChem CID 51346932) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is 6-[(2S)-2-(2-methoxyphenyl)morpholin-4-yl]-1-methyl-4-pyrimidin-4-ylpyridin-2-one.
| Compound Name | 6-[(2S)-2-(2-methoxyphenyl)morpholin-4-yl]-1-methyl-4-pyrimidin-4-ylpyridin-2-one |
|---|---|
| PubChem CID | 51346932 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 6-[(2S)-2-(2-methoxyphenyl)morpholin-4-yl]-1-methyl-4-pyrimidin-4-ylpyridin-2-one |
| SMILES | COc1ccccc1[C@H]1CN(c2cc(-c3ccncn3)cc(=O)n2C)CCO1 |
| InChI | InChI=1S/C21H22N4O3/c1-24-20(11-15(12-21(24)26)17-7-8-22-14-23-17)25-9-10-28-19(13-25)16-5-3-4-6-18(16)27-2/h3-8,11-12,14,19H,9-10,13H2,1-2H3/t19-/m1/s1 |
| InChIKey | UXIBAVJUVOXYPB-LJQANCHMSA-N |
| XLogP | 2.43 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |