About 2-[(E)-2-[3,4-bis(difluoromethoxy)phenyl]ethenyl]-3,1-benzoxazin-4-one
2-[(E)-2-[3,4-bis(difluoromethoxy)phenyl]ethenyl]-3,1-benzoxazin-4-one (PubChem CID 51346976) has the molecular formula C18H11F4NO4
and a molecular weight of 381.28 g/mol. Its IUPAC name is 2-[(E)-2-[3,4-bis(difluoromethoxy)phenyl]ethenyl]-3,1-benzoxazin-4-one.
Molecular Properties
| Compound Name | 2-[(E)-2-[3,4-bis(difluoromethoxy)phenyl]ethenyl]-3,1-benzoxazin-4-one |
| PubChem CID | 51346976 |
| Molecular Formula | C18H11F4NO4 |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 2-[(E)-2-[3,4-bis(difluoromethoxy)phenyl]ethenyl]-3,1-benzoxazin-4-one |
| SMILES | O=c1oc(/C=C/c2ccc(OC(F)F)c(OC(F)F)c2)nc2ccccc12 |
| InChI | InChI=1S/C18H11F4NO4/c19-17(20)25-13-7-5-10(9-14(13)26-18(21)22)6-8-15-23-12-4-2-1-3-11(12)16(24)27-15/h1-9,17-18H/b8-6+ |
| InChIKey | LSOCRFYTBUHIGW-SOFGYWHQSA-N |
| XLogP | 4.56 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(E)-2-[3,4-bis(difluoromethoxy)phenyl]ethenyl]-3,1-benzoxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-[3,4-bis(difluoromethoxy)phenyl]ethenyl]-3,1-benzoxazin-4-one?
The IUPAC name of 2-[(E)-2-[3,4-bis(difluoromethoxy)phenyl]ethenyl]-3,1-benzoxazin-4-one (CID 51346976) is 2-[(E)-2-[3,4-bis(difluoromethoxy)phenyl]ethenyl]-3,1-benzoxazin-4-one.
What is the SMILES notation for 2-[(E)-2-[3,4-bis(difluoromethoxy)phenyl]ethenyl]-3,1-benzoxazin-4-one?
The canonical SMILES for 2-[(E)-2-[3,4-bis(difluoromethoxy)phenyl]ethenyl]-3,1-benzoxazin-4-one is O=c1oc(/C=C/c2ccc(OC(F)F)c(OC(F)F)c2)nc2ccccc12.
What is the InChIKey of 2-[(E)-2-[3,4-bis(difluoromethoxy)phenyl]ethenyl]-3,1-benzoxazin-4-one?
The InChIKey is LSOCRFYTBUHIGW-SOFGYWHQSA-N. The full InChI is InChI=1S/C18H11F4NO4/c19-17(20)25-13-7-5-10(9-14(13)26-18(21)22)6-8-15-23-12-4-2-1-3-11(12)16(24)27-15/h1-9,17-18H/b8-6+.
What are the key properties of 2-[(E)-2-[3,4-bis(difluoromethoxy)phenyl]ethenyl]-3,1-benzoxazin-4-one?
2-[(E)-2-[3,4-bis(difluoromethoxy)phenyl]ethenyl]-3,1-benzoxazin-4-one has a molecular weight of 381.28 g/mol, XLogP of 4.56, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-[3,4-bis(difluoromethoxy)phenyl]ethenyl]-3,1-benzoxazin-4-one is sourced from PubChem (CID 51346976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).