C29H27F2N3O3 — CID 51347001
[(3R,4S)-5,7-difluoro-6-(1H-indol-7-yl)-2,2,4-trimethyl-3,4-dihydro-1H-quinolin-3-yl] N-(4-acetylphenyl)carbamate (PubChem CID 51347001) has the molecular formula C29H27F2N3O3 and a molecular weight of 503.55 g/mol. Its IUPAC name is [(3R,4S)-5,7-difluoro-6-(1H-indol-7-yl)-2,2,4-trimethyl-3,4-dihydro-1H-quinolin-3-yl] N-(4-acetylphenyl)carbamate.
| Compound Name | [(3R,4S)-5,7-difluoro-6-(1H-indol-7-yl)-2,2,4-trimethyl-3,4-dihydro-1H-quinolin-3-yl] N-(4-acetylphenyl)carbamate |
|---|---|
| PubChem CID | 51347001 |
| Molecular Formula | C29H27F2N3O3 |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | [(3R,4S)-5,7-difluoro-6-(1H-indol-7-yl)-2,2,4-trimethyl-3,4-dihydro-1H-quinolin-3-yl] N-(4-acetylphenyl)carbamate |
| SMILES | CC(=O)c1ccc(NC(=O)O[C@@H]2[C@@H](C)c3c(cc(F)c(-c4cccc5cc[nH]c45)c3F)NC2(C)C)cc1 |
| InChI | InChI=1S/C29H27F2N3O3/c1-15-23-22(14-21(30)24(25(23)31)20-7-5-6-18-12-13-32-26(18)20)34-29(3,4)27(15)37-28(36)33-19-10-8-17(9-11-19)16(2)35/h5-15,27,32,34H,1-4H3,(H,33,36)/t15-,27+/m0/s1 |
| InChIKey | PEEQAQFTZGENDO-KUNJGFBQSA-N |
| XLogP | 7.24 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |