C23H17FN2O4 — CID 51347039
2-fluoro-6-hydroxy-4-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzoic acid (PubChem CID 51347039) has the molecular formula C23H17FN2O4 and a molecular weight of 404.40 g/mol. Its IUPAC name is 2-fluoro-6-hydroxy-4-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzoic acid.
| Compound Name | 2-fluoro-6-hydroxy-4-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzoic acid |
|---|---|
| PubChem CID | 51347039 |
| Molecular Formula | C23H17FN2O4 |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 2-fluoro-6-hydroxy-4-(2-oxo-5,6-diphenyl-3,4-dihydro-1H-pyrimidin-4-yl)benzoic acid |
| SMILES | O=C1NC(c2ccccc2)=C(c2ccccc2)C(c2cc(O)c(C(=O)O)c(F)c2)N1 |
| InChI | InChI=1S/C23H17FN2O4/c24-16-11-15(12-17(27)19(16)22(28)29)21-18(13-7-3-1-4-8-13)20(25-23(30)26-21)14-9-5-2-6-10-14/h1-12,21,27H,(H,28,29)(H2,25,26,30) |
| InChIKey | YGUFBVGTCSVOPX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|