C18H17F3N4O3 — CID 51347348
3-(3,5-dimethyl-1,2-oxazol-4-yl)-N'-hydroxy-4-(4-hydroxyphenyl)-1-methyl-5-(trifluoromethyl)pyrrole-2-carboximidamide (PubChem CID 51347348) has the molecular formula C18H17F3N4O3 and a molecular weight of 394.35 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1,2-oxazol-4-yl)-N'-hydroxy-4-(4-hydroxyphenyl)-1-methyl-5-(trifluoromethyl)pyrrole-2-carboximidamide.
| Compound Name | 3-(3,5-dimethyl-1,2-oxazol-4-yl)-N'-hydroxy-4-(4-hydroxyphenyl)-1-methyl-5-(trifluoromethyl)pyrrole-2-carboximidamide |
|---|---|
| PubChem CID | 51347348 |
| Molecular Formula | C18H17F3N4O3 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 3-(3,5-dimethyl-1,2-oxazol-4-yl)-N'-hydroxy-4-(4-hydroxyphenyl)-1-methyl-5-(trifluoromethyl)pyrrole-2-carboximidamide |
| SMILES | Cc1noc(C)c1-c1c(-c2ccc(O)cc2)c(C(F)(F)F)n(C)c1/C(N)=N/O |
| InChI | InChI=1S/C18H17F3N4O3/c1-8-12(9(2)28-24-8)14-13(10-4-6-11(26)7-5-10)16(18(19,20)21)25(3)15(14)17(22)23-27/h4-7,26-27H,1-3H3,(H2,22,23) |
| InChIKey | LSZBNOOSFGLCMO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 109.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|