C26H29F2N3O — CID 51347440
3-(2,4-difluorophenyl)-4-(5,15-dimethyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-N-methylbutanamide (PubChem CID 51347440) has the molecular formula C26H29F2N3O and a molecular weight of 437.53 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-4-(5,15-dimethyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-N-methylbutanamide.
| Compound Name | 3-(2,4-difluorophenyl)-4-(5,15-dimethyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-N-methylbutanamide |
|---|---|
| PubChem CID | 51347440 |
| Molecular Formula | C26H29F2N3O |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 3-(2,4-difluorophenyl)-4-(5,15-dimethyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-N-methylbutanamide |
| SMILES | CNC(=O)CC(Cn1c2c(c3cc(C)ccc31)C1CCC(C2)N1C)c1ccc(F)cc1F |
| InChI | InChI=1S/C26H29F2N3O/c1-15-4-8-22-20(10-15)26-23-9-6-18(30(23)3)13-24(26)31(22)14-16(11-25(32)29-2)19-7-5-17(27)12-21(19)28/h4-5,7-8,10,12,16,18,23H,6,9,11,13-14H2,1-3H3,(H,29,32) |
| InChIKey | OMLIQLUOOUSJIR-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|