C26H31N3O2 — CID 51347443
ethyl 4-(5,15-dimethyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-3-pyridin-4-ylbutanoate (PubChem CID 51347443) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is ethyl 4-(5,15-dimethyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-3-pyridin-4-ylbutanoate.
| Compound Name | ethyl 4-(5,15-dimethyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-3-pyridin-4-ylbutanoate |
|---|---|
| PubChem CID | 51347443 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | ethyl 4-(5,15-dimethyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-3-pyridin-4-ylbutanoate |
| SMILES | CCOC(=O)CC(Cn1c2c(c3cc(C)ccc31)C1CCC(C2)N1C)c1ccncc1 |
| InChI | InChI=1S/C26H31N3O2/c1-4-31-25(30)14-19(18-9-11-27-12-10-18)16-29-22-7-5-17(2)13-21(22)26-23-8-6-20(28(23)3)15-24(26)29/h5,7,9-13,19-20,23H,4,6,8,14-16H2,1-3H3 |
| InChIKey | PVKMTRLEOQPNEU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|