C23H16FN5OS — CID 51347631
4-(2-fluorophenyl)-8-[(1-methylindazol-5-yl)methyl]-12-thia-3,4,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,6,10-tetraen-5-one (PubChem CID 51347631) has the molecular formula C23H16FN5OS and a molecular weight of 429.48 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-8-[(1-methylindazol-5-yl)methyl]-12-thia-3,4,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,6,10-tetraen-5-one.
| Compound Name | 4-(2-fluorophenyl)-8-[(1-methylindazol-5-yl)methyl]-12-thia-3,4,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,6,10-tetraen-5-one |
|---|---|
| PubChem CID | 51347631 |
| Molecular Formula | C23H16FN5OS |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 4-(2-fluorophenyl)-8-[(1-methylindazol-5-yl)methyl]-12-thia-3,4,8-triazatricyclo[7.3.0.02,6]dodeca-1(9),2,6,10-tetraen-5-one |
| SMILES | Cn1ncc2cc(Cn3cc4c(=O)n(-c5ccccc5F)nc-4c4sccc43)ccc21 |
| InChI | InChI=1S/C23H16FN5OS/c1-27-18-7-6-14(10-15(18)11-25-27)12-28-13-16-21(22-20(28)8-9-31-22)26-29(23(16)30)19-5-3-2-4-17(19)24/h2-11,13H,12H2,1H3 |
| InChIKey | UGZVKGZEGGZPIW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 57.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |