C24H28N6O3S — CID 51347634
9-[2-(2,2-dimethylpropylamino)ethyl]-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-6-amine (PubChem CID 51347634) has the molecular formula C24H28N6O3S and a molecular weight of 480.59 g/mol. Its IUPAC name is 9-[2-(2,2-dimethylpropylamino)ethyl]-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-6-amine.
| Compound Name | 9-[2-(2,2-dimethylpropylamino)ethyl]-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-6-amine |
|---|---|
| PubChem CID | 51347634 |
| Molecular Formula | C24H28N6O3S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 9-[2-(2,2-dimethylpropylamino)ethyl]-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-6-amine |
| SMILES | Cc1ccc(-c2cc3c(cc2Sc2nc4c(N)ncnc4n2CCNCC(C)(C)C)OCO3)o1 |
| InChI | InChI=1S/C24H28N6O3S/c1-14-5-6-16(33-14)15-9-17-18(32-13-31-17)10-19(15)34-23-29-20-21(25)27-12-28-22(20)30(23)8-7-26-11-24(2,3)4/h5-6,9-10,12,26H,7-8,11,13H2,1-4H3,(H2,25,27,28) |
| InChIKey | ARGYBNGENDCNMI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 113.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|