C24H29N7O3S — CID 51347635
8-[[6-[5-(aminomethyl)furan-2-yl]-1,3-benzodioxol-5-yl]sulfanyl]-9-[2-(2,2-dimethylpropylamino)ethyl]purin-6-amine (PubChem CID 51347635) has the molecular formula C24H29N7O3S and a molecular weight of 495.61 g/mol. Its IUPAC name is 8-[[6-[5-(aminomethyl)furan-2-yl]-1,3-benzodioxol-5-yl]sulfanyl]-9-[2-(2,2-dimethylpropylamino)ethyl]purin-6-amine.
| Compound Name | 8-[[6-[5-(aminomethyl)furan-2-yl]-1,3-benzodioxol-5-yl]sulfanyl]-9-[2-(2,2-dimethylpropylamino)ethyl]purin-6-amine |
|---|---|
| PubChem CID | 51347635 |
| Molecular Formula | C24H29N7O3S |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 8-[[6-[5-(aminomethyl)furan-2-yl]-1,3-benzodioxol-5-yl]sulfanyl]-9-[2-(2,2-dimethylpropylamino)ethyl]purin-6-amine |
| SMILES | CC(C)(C)CNCCn1c(Sc2cc3c(cc2-c2ccc(CN)o2)OCO3)nc2c(N)ncnc21 |
| InChI | InChI=1S/C24H29N7O3S/c1-24(2,3)11-27-6-7-31-22-20(21(26)28-12-29-22)30-23(31)35-19-9-18-17(32-13-33-18)8-15(19)16-5-4-14(10-25)34-16/h4-5,8-9,12,27H,6-7,10-11,13,25H2,1-3H3,(H2,26,28,29) |
| InChIKey | BMLYOWQWBQTLMV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 139.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|