C22H24N6O5S2 — CID 51347636
5-[6-amino-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]pentane-1-sulfonamide (PubChem CID 51347636) has the molecular formula C22H24N6O5S2 and a molecular weight of 516.61 g/mol. Its IUPAC name is 5-[6-amino-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]pentane-1-sulfonamide.
| Compound Name | 5-[6-amino-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]pentane-1-sulfonamide |
|---|---|
| PubChem CID | 51347636 |
| Molecular Formula | C22H24N6O5S2 |
| Molecular Weight | 516.61 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | 5-[6-amino-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]pentane-1-sulfonamide |
| SMILES | Cc1ccc(-c2cc3c(cc2Sc2nc4c(N)ncnc4n2CCCCCS(N)(=O)=O)OCO3)o1 |
| InChI | InChI=1S/C22H24N6O5S2/c1-13-5-6-15(33-13)14-9-16-17(32-12-31-16)10-18(14)34-22-27-19-20(23)25-11-26-21(19)28(22)7-3-2-4-8-35(24,29)30/h5-6,9-11H,2-4,7-8,12H2,1H3,(H2,23,25,26)(H2,24,29,30) |
| InChIKey | CPALGODMRXYLCH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 161.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.61 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|