C23H25FN6O5S — CID 51347791
5-[6-amino-2-fluoro-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]methyl]purin-9-yl]pentane-1-sulfonamide (PubChem CID 51347791) has the molecular formula C23H25FN6O5S and a molecular weight of 516.56 g/mol. Its IUPAC name is 5-[6-amino-2-fluoro-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]methyl]purin-9-yl]pentane-1-sulfonamide.
| Compound Name | 5-[6-amino-2-fluoro-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]methyl]purin-9-yl]pentane-1-sulfonamide |
|---|---|
| PubChem CID | 51347791 |
| Molecular Formula | C23H25FN6O5S |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | 5-[6-amino-2-fluoro-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]methyl]purin-9-yl]pentane-1-sulfonamide |
| SMILES | Cc1ccc(-c2cc3c(cc2Cc2nc4c(N)nc(F)nc4n2CCCCCS(N)(=O)=O)OCO3)o1 |
| InChI | InChI=1S/C23H25FN6O5S/c1-13-5-6-16(35-13)15-11-18-17(33-12-34-18)9-14(15)10-19-27-20-21(25)28-23(24)29-22(20)30(19)7-3-2-4-8-36(26,31)32/h5-6,9,11H,2-4,7-8,10,12H2,1H3,(H2,25,28,29)(H2,26,31,32) |
| InChIKey | WPGBHWKUKSGWPY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 161.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|