C24H25FN6O4 — CID 51347792
6-[6-amino-2-fluoro-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]methyl]purin-9-yl]hexanamide (PubChem CID 51347792) has the molecular formula C24H25FN6O4 and a molecular weight of 480.50 g/mol. Its IUPAC name is 6-[6-amino-2-fluoro-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]methyl]purin-9-yl]hexanamide.
| Compound Name | 6-[6-amino-2-fluoro-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]methyl]purin-9-yl]hexanamide |
|---|---|
| PubChem CID | 51347792 |
| Molecular Formula | C24H25FN6O4 |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 6-[6-amino-2-fluoro-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]methyl]purin-9-yl]hexanamide |
| SMILES | Cc1ccc(-c2cc3c(cc2Cc2nc4c(N)nc(F)nc4n2CCCCCC(N)=O)OCO3)o1 |
| InChI | InChI=1S/C24H25FN6O4/c1-13-6-7-16(35-13)15-11-18-17(33-12-34-18)9-14(15)10-20-28-21-22(27)29-24(25)30-23(21)31(20)8-4-2-3-5-19(26)32/h6-7,9,11H,2-5,8,10,12H2,1H3,(H2,26,32)(H2,27,29,30) |
| InChIKey | OHBXBZQKMLITDK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 144.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|