C24H19F2N3O5 — CID 51347929
5-(3,4-difluorophenyl)-4-(3-ethoxy-4-hydroxy-5-nitrophenyl)-6-phenyl-3,4-dihydro-1H-pyrimidin-2-one (PubChem CID 51347929) has the molecular formula C24H19F2N3O5 and a molecular weight of 467.43 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)-4-(3-ethoxy-4-hydroxy-5-nitrophenyl)-6-phenyl-3,4-dihydro-1H-pyrimidin-2-one.
| Compound Name | 5-(3,4-difluorophenyl)-4-(3-ethoxy-4-hydroxy-5-nitrophenyl)-6-phenyl-3,4-dihydro-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 51347929 |
| Molecular Formula | C24H19F2N3O5 |
| Molecular Weight | 467.43 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 5-(3,4-difluorophenyl)-4-(3-ethoxy-4-hydroxy-5-nitrophenyl)-6-phenyl-3,4-dihydro-1H-pyrimidin-2-one |
| SMILES | CCOc1cc(C2NC(=O)NC(c3ccccc3)=C2c2ccc(F)c(F)c2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C24H19F2N3O5/c1-2-34-19-12-15(11-18(23(19)30)29(32)33)22-20(14-8-9-16(25)17(26)10-14)21(27-24(31)28-22)13-6-4-3-5-7-13/h3-12,22,30H,2H2,1H3,(H2,27,28,31) |
| InChIKey | RMEYEQFAYKGIBA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.43 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|