C24H27FN6O3 — CID 51347940
2-fluoro-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]methyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine (PubChem CID 51347940) has the molecular formula C24H27FN6O3 and a molecular weight of 466.52 g/mol. Its IUPAC name is 2-fluoro-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]methyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine.
| Compound Name | 2-fluoro-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]methyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine |
|---|---|
| PubChem CID | 51347940 |
| Molecular Formula | C24H27FN6O3 |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 2-fluoro-8-[[6-(5-methylfuran-2-yl)-1,3-benzodioxol-5-yl]methyl]-9-[3-(propan-2-ylamino)propyl]purin-6-amine |
| SMILES | Cc1ccc(-c2cc3c(cc2Cc2nc4c(N)nc(F)nc4n2CCCNC(C)C)OCO3)o1 |
| InChI | InChI=1S/C24H27FN6O3/c1-13(2)27-7-4-8-31-20(28-21-22(26)29-24(25)30-23(21)31)10-15-9-18-19(33-12-32-18)11-16(15)17-6-5-14(3)34-17/h5-6,9,11,13,27H,4,7-8,10,12H2,1-3H3,(H2,26,29,30) |
| InChIKey | RCGCANBTBQGYHH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 113.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|