C23H27N7O3S — CID 51348085
9-[3-(tert-butylamino)propyl]-8-[[6-(5-methyl-1,3-oxazol-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-6-amine (PubChem CID 51348085) has the molecular formula C23H27N7O3S and a molecular weight of 481.58 g/mol. Its IUPAC name is 9-[3-(tert-butylamino)propyl]-8-[[6-(5-methyl-1,3-oxazol-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-6-amine.
| Compound Name | 9-[3-(tert-butylamino)propyl]-8-[[6-(5-methyl-1,3-oxazol-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-6-amine |
|---|---|
| PubChem CID | 51348085 |
| Molecular Formula | C23H27N7O3S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | 9-[3-(tert-butylamino)propyl]-8-[[6-(5-methyl-1,3-oxazol-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-6-amine |
| SMILES | Cc1cnc(-c2cc3c(cc2Sc2nc4c(N)ncnc4n2CCCNC(C)(C)C)OCO3)o1 |
| InChI | InChI=1S/C23H27N7O3S/c1-13-10-25-21(33-13)14-8-15-16(32-12-31-15)9-17(14)34-22-29-18-19(24)26-11-27-20(18)30(22)7-5-6-28-23(2,3)4/h8-11,28H,5-7,12H2,1-4H3,(H2,24,26,27) |
| InChIKey | RLFVZAHZDIPMMY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 126.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|