C21H23N7O5S2 — CID 51348087
5-[6-amino-8-[[6-(5-methyl-1,3-oxazol-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]pentane-1-sulfonamide (PubChem CID 51348087) has the molecular formula C21H23N7O5S2 and a molecular weight of 517.59 g/mol. Its IUPAC name is 5-[6-amino-8-[[6-(5-methyl-1,3-oxazol-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]pentane-1-sulfonamide.
| Compound Name | 5-[6-amino-8-[[6-(5-methyl-1,3-oxazol-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]pentane-1-sulfonamide |
|---|---|
| PubChem CID | 51348087 |
| Molecular Formula | C21H23N7O5S2 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | 5-[6-amino-8-[[6-(5-methyl-1,3-oxazol-2-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]pentane-1-sulfonamide |
| SMILES | Cc1cnc(-c2cc3c(cc2Sc2nc4c(N)ncnc4n2CCCCCS(N)(=O)=O)OCO3)o1 |
| InChI | InChI=1S/C21H23N7O5S2/c1-12-9-24-20(33-12)13-7-14-15(32-11-31-14)8-16(13)34-21-27-17-18(22)25-10-26-19(17)28(21)5-3-2-4-6-35(23,29)30/h7-10H,2-6,11H2,1H3,(H2,22,25,26)(H2,23,29,30) |
| InChIKey | AXHHPCIGPOMCDH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 174.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|