C20H21N9O4S — CID 51348226
3-[2-[6-amino-8-[[6-(1H-pyrazol-5-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]ethylamino]-N-hydroxypropanamide (PubChem CID 51348226) has the molecular formula C20H21N9O4S and a molecular weight of 483.51 g/mol. Its IUPAC name is 3-[2-[6-amino-8-[[6-(1H-pyrazol-5-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]ethylamino]-N-hydroxypropanamide.
| Compound Name | 3-[2-[6-amino-8-[[6-(1H-pyrazol-5-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]ethylamino]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 51348226 |
| Molecular Formula | C20H21N9O4S |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 3-[2-[6-amino-8-[[6-(1H-pyrazol-5-yl)-1,3-benzodioxol-5-yl]sulfanyl]purin-9-yl]ethylamino]-N-hydroxypropanamide |
| SMILES | Nc1ncnc2c1nc(Sc1cc3c(cc1-c1ccn[nH]1)OCO3)n2CCNCCC(=O)NO |
| InChI | InChI=1S/C20H21N9O4S/c21-18-17-19(24-9-23-18)29(6-5-22-3-2-16(30)28-31)20(26-17)34-15-8-14-13(32-10-33-14)7-11(15)12-1-4-25-27-12/h1,4,7-9,22,31H,2-3,5-6,10H2,(H,25,27)(H,28,30)(H2,21,23,24) |
| InChIKey | IOXYHLBPDQAZHN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 178.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|