C19H19Cl4FN2O2 — CID 51348327
2,2,2-trichloroethyl 3-(5-chloro-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-2-fluoropropanoate (PubChem CID 51348327) has the molecular formula C19H19Cl4FN2O2 and a molecular weight of 468.18 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 3-(5-chloro-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-2-fluoropropanoate.
| Compound Name | 2,2,2-trichloroethyl 3-(5-chloro-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-2-fluoropropanoate |
|---|---|
| PubChem CID | 51348327 |
| Molecular Formula | C19H19Cl4FN2O2 |
| Molecular Weight | 468.18 g/mol |
| Exact Mass | 466.02 |
| IUPAC Name | 2,2,2-trichloroethyl 3-(5-chloro-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-2-fluoropropanoate |
| SMILES | CN1C2CCC1c1c(n(CC(F)C(=O)OCC(Cl)(Cl)Cl)c3ccc(Cl)cc13)C2 |
| InChI | InChI=1S/C19H19Cl4FN2O2/c1-25-11-3-5-15(25)17-12-6-10(20)2-4-14(12)26(16(17)7-11)8-13(24)18(27)28-9-19(21,22)23/h2,4,6,11,13,15H,3,5,7-9H2,1H3 |
| InChIKey | OSDBZZWORJEPFC-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.18 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|