C20H20F3NO3 — CID 51348447
2-[1-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]pyrrolidin-2-yl]acetic acid (PubChem CID 51348447) has the molecular formula C20H20F3NO3 and a molecular weight of 379.38 g/mol. Its IUPAC name is 2-[1-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]pyrrolidin-2-yl]acetic acid.
| Compound Name | 2-[1-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]pyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 51348447 |
| Molecular Formula | C20H20F3NO3 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 2-[1-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]pyrrolidin-2-yl]acetic acid |
| SMILES | O=C(O)CC1CCCN1c1ccc(OCc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H20F3NO3/c21-20(22,23)15-4-1-3-14(11-15)13-27-18-8-6-16(7-9-18)24-10-2-5-17(24)12-19(25)26/h1,3-4,6-9,11,17H,2,5,10,12-13H2,(H,25,26) |
| InChIKey | FSZGDMRCPNZHAD-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|