C34H44N2O4 — CID 51348449
N-[2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethyl]-5-methyl-4-oxo-5-phenylfuran-2-carboxamide (PubChem CID 51348449) has the molecular formula C34H44N2O4 and a molecular weight of 544.74 g/mol. Its IUPAC name is N-[2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethyl]-5-methyl-4-oxo-5-phenylfuran-2-carboxamide.
| Compound Name | N-[2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethyl]-5-methyl-4-oxo-5-phenylfuran-2-carboxamide |
|---|---|
| PubChem CID | 51348449 |
| Molecular Formula | C34H44N2O4 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | N-[2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]ethyl]-5-methyl-4-oxo-5-phenylfuran-2-carboxamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NCCNC(=O)C1=CC(=O)C(C)(c2ccccc2)O1 |
| InChI | InChI=1S/C34H44N2O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-25-32(38)35-26-27-36-33(39)30-28-31(37)34(2,40-30)29-23-20-19-21-24-29/h4-5,7-8,10-11,13-14,16-17,19-21,23-24,28H,3,6,9,12,15,18,22,25-27H2,1-2H3,(H,35,38)(H,36,39)/b5-4-,8-7-,11-10-,14-13-,17-16- |
| InChIKey | FBHHEAWJWHUHAQ-JEBPEJKESA-N |
| XLogP | 6.54 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|