C25H35ClN4O — CID 51348479
2-[(5-chloro-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)methyl]-3-methyl-N-piperidin-3-ylbutanamide (PubChem CID 51348479) has the molecular formula C25H35ClN4O and a molecular weight of 443.04 g/mol. Its IUPAC name is 2-[(5-chloro-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)methyl]-3-methyl-N-piperidin-3-ylbutanamide.
| Compound Name | 2-[(5-chloro-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)methyl]-3-methyl-N-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 51348479 |
| Molecular Formula | C25H35ClN4O |
| Molecular Weight | 443.04 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 2-[(5-chloro-15-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)methyl]-3-methyl-N-piperidin-3-ylbutanamide |
| SMILES | CC(C)C(Cn1c2c(c3cc(Cl)ccc31)C1CCC(C2)N1C)C(=O)NC1CCCNC1 |
| InChI | InChI=1S/C25H35ClN4O/c1-15(2)20(25(31)28-17-5-4-10-27-13-17)14-30-21-8-6-16(26)11-19(21)24-22-9-7-18(29(22)3)12-23(24)30/h6,8,11,15,17-18,20,22,27H,4-5,7,9-10,12-14H2,1-3H3,(H,28,31) |
| InChIKey | MEBAYCGWYQBUSD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.04 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|