C23H26N6O5S2 — CID 51348674
5-[6-amino-8-[[7-(5-methylfuran-2-yl)-2,3-dihydro-1,4-benzodioxin-6-yl]sulfanyl]purin-9-yl]pentane-1-sulfonamide (PubChem CID 51348674) has the molecular formula C23H26N6O5S2 and a molecular weight of 530.63 g/mol. Its IUPAC name is 5-[6-amino-8-[[7-(5-methylfuran-2-yl)-2,3-dihydro-1,4-benzodioxin-6-yl]sulfanyl]purin-9-yl]pentane-1-sulfonamide.
| Compound Name | 5-[6-amino-8-[[7-(5-methylfuran-2-yl)-2,3-dihydro-1,4-benzodioxin-6-yl]sulfanyl]purin-9-yl]pentane-1-sulfonamide |
|---|---|
| PubChem CID | 51348674 |
| Molecular Formula | C23H26N6O5S2 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | 5-[6-amino-8-[[7-(5-methylfuran-2-yl)-2,3-dihydro-1,4-benzodioxin-6-yl]sulfanyl]purin-9-yl]pentane-1-sulfonamide |
| SMILES | Cc1ccc(-c2cc3c(cc2Sc2nc4c(N)ncnc4n2CCCCCS(N)(=O)=O)OCCO3)o1 |
| InChI | InChI=1S/C23H26N6O5S2/c1-14-5-6-16(34-14)15-11-17-18(33-9-8-32-17)12-19(15)35-23-28-20-21(24)26-13-27-22(20)29(23)7-3-2-4-10-36(25,30)31/h5-6,11-13H,2-4,7-10H2,1H3,(H2,24,26,27)(H2,25,30,31) |
| InChIKey | WIXUYCBNZSJJLO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 161.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|