C23H25N7O4S — CID 51348817
6-[6-amino-8-[[7-(5-methyl-1,3-oxazol-2-yl)-2,3-dihydro-1,4-benzodioxin-6-yl]sulfanyl]purin-9-yl]hexanamide (PubChem CID 51348817) has the molecular formula C23H25N7O4S and a molecular weight of 495.57 g/mol. Its IUPAC name is 6-[6-amino-8-[[7-(5-methyl-1,3-oxazol-2-yl)-2,3-dihydro-1,4-benzodioxin-6-yl]sulfanyl]purin-9-yl]hexanamide.
| Compound Name | 6-[6-amino-8-[[7-(5-methyl-1,3-oxazol-2-yl)-2,3-dihydro-1,4-benzodioxin-6-yl]sulfanyl]purin-9-yl]hexanamide |
|---|---|
| PubChem CID | 51348817 |
| Molecular Formula | C23H25N7O4S |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 6-[6-amino-8-[[7-(5-methyl-1,3-oxazol-2-yl)-2,3-dihydro-1,4-benzodioxin-6-yl]sulfanyl]purin-9-yl]hexanamide |
| SMILES | Cc1cnc(-c2cc3c(cc2Sc2nc4c(N)ncnc4n2CCCCCC(N)=O)OCCO3)o1 |
| InChI | InChI=1S/C23H25N7O4S/c1-13-11-26-22(34-13)14-9-15-16(33-8-7-32-15)10-17(14)35-23-29-19-20(25)27-12-28-21(19)30(23)6-4-2-3-5-18(24)31/h9-12H,2-8H2,1H3,(H2,24,31)(H2,25,27,28) |
| InChIKey | MLURLKKYJPSRMZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 157.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|