C43H55ClN2O4S2 — CID 51349019
(4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[2-[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]ethyldisulfanyl]ethyl]docosa-4,7,10,13,16,19-hexaenamide (PubChem CID 51349019) has the molecular formula C43H55ClN2O4S2 and a molecular weight of 763.51 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[2-[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]ethyldisulfanyl]ethyl]docosa-4,7,10,13,16,19-hexaenamide.
| Compound Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[2-[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]ethyldisulfanyl]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
|---|---|
| PubChem CID | 51349019 |
| Molecular Formula | C43H55ClN2O4S2 |
| Molecular Weight | 763.51 g/mol |
| Exact Mass | 762.33 |
| IUPAC Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[2-[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]ethyldisulfanyl]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCSSCCNC(=O)C(C)(C)Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C43H55ClN2O4S2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-40(47)45-32-34-51-52-35-33-46-42(49)43(2,3)50-39-30-26-37(27-31-39)41(48)36-24-28-38(44)29-25-36/h5-6,8-9,11-12,14-15,17-18,20-21,24-31H,4,7,10,13,16,19,22-23,32-35H2,1-3H3,(H,45,47)(H,46,49)/b6-5-,9-8-,12-11-,15-14-,18-17-,21-20- |
| InChIKey | LJMWAMIYVIUZNF-YNUSHXQLSA-N |
| XLogP | 10.82 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.51 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|