C45H57ClN2O6 — CID 51349020
2-[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]-6-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]hexanoic acid (PubChem CID 51349020) has the molecular formula C45H57ClN2O6 and a molecular weight of 757.41 g/mol. Its IUPAC name is 2-[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]-6-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]hexanoic acid.
| Compound Name | 2-[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]-6-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 51349020 |
| Molecular Formula | C45H57ClN2O6 |
| Molecular Weight | 757.41 g/mol |
| Exact Mass | 756.39 |
| IUPAC Name | 2-[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]-6-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]hexanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCCCC(NC(=O)C(C)(C)Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C45H57ClN2O6/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-26-41(49)47-35-24-23-25-40(43(51)52)48-44(53)45(2,3)54-39-33-29-37(30-34-39)42(50)36-27-31-38(46)32-28-36/h5-6,8-9,11-12,14-15,17-18,20-21,27-34,40H,4,7,10,13,16,19,22-26,35H2,1-3H3,(H,47,49)(H,48,53)(H,51,52)/b6-5-,9-8-,12-11-,15-14-,18-17-,21-20- |
| InChIKey | AOPXJFCSTFFZML-YNUSHXQLSA-N |
| XLogP | 10.06 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.41 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|