C43H56ClN3O4 — CID 51349156
(4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[2-[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]ethylamino]ethyl]docosa-4,7,10,13,16,19-hexaenamide (PubChem CID 51349156) has the molecular formula C43H56ClN3O4 and a molecular weight of 714.39 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[2-[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]ethylamino]ethyl]docosa-4,7,10,13,16,19-hexaenamide.
| Compound Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[2-[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]ethylamino]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
|---|---|
| PubChem CID | 51349156 |
| Molecular Formula | C43H56ClN3O4 |
| Molecular Weight | 714.39 g/mol |
| Exact Mass | 713.40 |
| IUPAC Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[2-[[2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoyl]amino]ethylamino]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCNCCNC(=O)C(C)(C)Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C43H56ClN3O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-40(48)46-34-32-45-33-35-47-42(50)43(2,3)51-39-30-26-37(27-31-39)41(49)36-24-28-38(44)29-25-36/h5-6,8-9,11-12,14-15,17-18,20-21,24-31,45H,4,7,10,13,16,19,22-23,32-35H2,1-3H3,(H,46,48)(H,47,50)/b6-5-,9-8-,12-11-,15-14-,18-17-,21-20- |
| InChIKey | NFDYQEULYSPWTN-YNUSHXQLSA-N |
| XLogP | 9.03 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.39 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|