C25H29FN2O — CID 51349179
1-(15-ethyl-5-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-2-(4-fluorophenyl)propan-2-ol (PubChem CID 51349179) has the molecular formula C25H29FN2O and a molecular weight of 392.52 g/mol. Its IUPAC name is 1-(15-ethyl-5-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-2-(4-fluorophenyl)propan-2-ol.
| Compound Name | 1-(15-ethyl-5-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-2-(4-fluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 51349179 |
| Molecular Formula | C25H29FN2O |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 1-(15-ethyl-5-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl)-2-(4-fluorophenyl)propan-2-ol |
| SMILES | CCN1C2CCC1c1c(n(CC(C)(O)c3ccc(F)cc3)c3ccc(C)cc13)C2 |
| InChI | InChI=1S/C25H29FN2O/c1-4-27-19-10-12-22(27)24-20-13-16(2)5-11-21(20)28(23(24)14-19)15-25(3,29)17-6-8-18(26)9-7-17/h5-9,11,13,19,22,29H,4,10,12,14-15H2,1-3H3 |
| InChIKey | XQAFPPGRESRDFP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|