C24H26F3N3O — CID 51349180
2-(6-methyl-3-pyridinyl)-1-[5-methyl-15-(trifluoromethyl)-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl]propan-2-ol (PubChem CID 51349180) has the molecular formula C24H26F3N3O and a molecular weight of 429.49 g/mol. Its IUPAC name is 2-(6-methyl-3-pyridinyl)-1-[5-methyl-15-(trifluoromethyl)-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl]propan-2-ol.
| Compound Name | 2-(6-methyl-3-pyridinyl)-1-[5-methyl-15-(trifluoromethyl)-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl]propan-2-ol |
|---|---|
| PubChem CID | 51349180 |
| Molecular Formula | C24H26F3N3O |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 2-(6-methyl-3-pyridinyl)-1-[5-methyl-15-(trifluoromethyl)-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-9-yl]propan-2-ol |
| SMILES | Cc1ccc2c(c1)c1c(n2CC(C)(O)c2ccc(C)nc2)CC2CCC1N2C(F)(F)F |
| InChI | InChI=1S/C24H26F3N3O/c1-14-4-8-19-18(10-14)22-20-9-7-17(30(20)24(25,26)27)11-21(22)29(19)13-23(3,31)16-6-5-15(2)28-12-16/h4-6,8,10,12,17,20,31H,7,9,11,13H2,1-3H3 |
| InChIKey | GHZSGRIRKOIQQG-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|