C20H16BrN5OS — CID 51349386
[4-[2-(4-bromophenyl)triazol-4-yl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-phenylmethanone (PubChem CID 51349386) has the molecular formula C20H16BrN5OS and a molecular weight of 454.35 g/mol. Its IUPAC name is [4-[2-(4-bromophenyl)triazol-4-yl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-phenylmethanone.
| Compound Name | [4-[2-(4-bromophenyl)triazol-4-yl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 51349386 |
| Molecular Formula | C20H16BrN5OS |
| Molecular Weight | 454.35 g/mol |
| Exact Mass | 453.03 |
| IUPAC Name | [4-[2-(4-bromophenyl)triazol-4-yl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-phenylmethanone |
| SMILES | CC1=C(C(=O)c2ccccc2)C(c2cnn(-c3ccc(Br)cc3)n2)NC(=S)N1 |
| InChI | InChI=1S/C20H16BrN5OS/c1-12-17(19(27)13-5-3-2-4-6-13)18(24-20(28)23-12)16-11-22-26(25-16)15-9-7-14(21)8-10-15/h2-11,18H,1H3,(H2,23,24,28) |
| InChIKey | LZSDIBYBMABCHT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|