About methyl 5-ethyl-2-methyl-7-trimethylsilyl-2-[2-tri(propan-2-yl)silyloxyethyl]hepta-5,6-dienoate
methyl 5-ethyl-2-methyl-7-trimethylsilyl-2-[2-tri(propan-2-yl)silyloxyethyl]hepta-5,6-dienoate (PubChem CID 51349764) has the molecular formula C25H50O3Si2
and a molecular weight of 454.84 g/mol. Its IUPAC name is methyl 5-ethyl-2-methyl-7-trimethylsilyl-2-[2-tri(propan-2-yl)silyloxyethyl]hepta-5,6-dienoate.
Molecular Properties
| Compound Name | methyl 5-ethyl-2-methyl-7-trimethylsilyl-2-[2-tri(propan-2-yl)silyloxyethyl]hepta-5,6-dienoate |
| PubChem CID | 51349764 |
| Molecular Formula | C25H50O3Si2 |
| Molecular Weight | 454.84 g/mol |
| Exact Mass | 454.33 |
| IUPAC Name | methyl 5-ethyl-2-methyl-7-trimethylsilyl-2-[2-tri(propan-2-yl)silyloxyethyl]hepta-5,6-dienoate |
| SMILES | CCC(=C=C[Si](C)(C)C)CCC(C)(CCO[Si](C(C)C)(C(C)C)C(C)C)C(=O)OC |
| InChI | InChI=1S/C25H50O3Si2/c1-13-23(15-19-29(10,11)12)14-16-25(8,24(26)27-9)17-18-28-30(20(2)3,21(4)5)22(6)7/h19-22H,13-14,16-18H2,1-12H3 |
| InChIKey | UMKRATWWQIWRSN-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.84 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-ethyl-2-methyl-7-trimethylsilyl-2-[2-tri(propan-2-yl)silyloxyethyl]hepta-5,6-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-ethyl-2-methyl-7-trimethylsilyl-2-[2-tri(propan-2-yl)silyloxyethyl]hepta-5,6-dienoate?
The IUPAC name of methyl 5-ethyl-2-methyl-7-trimethylsilyl-2-[2-tri(propan-2-yl)silyloxyethyl]hepta-5,6-dienoate (CID 51349764) is methyl 5-ethyl-2-methyl-7-trimethylsilyl-2-[2-tri(propan-2-yl)silyloxyethyl]hepta-5,6-dienoate.
What is the SMILES notation for methyl 5-ethyl-2-methyl-7-trimethylsilyl-2-[2-tri(propan-2-yl)silyloxyethyl]hepta-5,6-dienoate?
The canonical SMILES for methyl 5-ethyl-2-methyl-7-trimethylsilyl-2-[2-tri(propan-2-yl)silyloxyethyl]hepta-5,6-dienoate is CCC(=C=C[Si](C)(C)C)CCC(C)(CCO[Si](C(C)C)(C(C)C)C(C)C)C(=O)OC.
What is the InChIKey of methyl 5-ethyl-2-methyl-7-trimethylsilyl-2-[2-tri(propan-2-yl)silyloxyethyl]hepta-5,6-dienoate?
The InChIKey is UMKRATWWQIWRSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H50O3Si2/c1-13-23(15-19-29(10,11)12)14-16-25(8,24(26)27-9)17-18-28-30(20(2)3,21(4)5)22(6)7/h19-22H,13-14,16-18H2,1-12H3.
What are the key properties of methyl 5-ethyl-2-methyl-7-trimethylsilyl-2-[2-tri(propan-2-yl)silyloxyethyl]hepta-5,6-dienoate?
methyl 5-ethyl-2-methyl-7-trimethylsilyl-2-[2-tri(propan-2-yl)silyloxyethyl]hepta-5,6-dienoate has a molecular weight of 454.84 g/mol, XLogP of 7.90, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-ethyl-2-methyl-7-trimethylsilyl-2-[2-tri(propan-2-yl)silyloxyethyl]hepta-5,6-dienoate is sourced from PubChem (CID 51349764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).