About 3-{4-[(4-Phenoxybenzyl)oxy]phenyl}propanoic Acid
3-{4-[(4-Phenoxybenzyl)oxy]phenyl}propanoic Acid (PubChem CID 51349861) has the molecular formula C22H20O4
and a molecular weight of 348.40 g/mol. Its IUPAC name is 3-[4-[(4-phenoxyphenyl)methoxy]phenyl]propanoic acid.
Molecular Properties
| Compound Name | 3-{4-[(4-Phenoxybenzyl)oxy]phenyl}propanoic Acid |
| PubChem CID | 51349861 |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 3-[4-[(4-phenoxyphenyl)methoxy]phenyl]propanoic acid |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)COC3=CC=C(C=C3)CCC(=O)O |
| InChI | InChI=1S/C22H20O4/c23-22(24)15-10-17-6-11-19(12-7-17)25-16-18-8-13-21(14-9-18)26-20-4-2-1-3-5-20/h1-9,11-14H,10,15-16H2,(H,23,24) |
| InChIKey | RJIGUHHUXAXYRM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 55.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | 402 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-{4-[(4-Phenoxybenzyl)oxy]phenyl}propanoic Acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-{4-[(4-Phenoxybenzyl)oxy]phenyl}propanoic Acid?
The IUPAC name of 3-{4-[(4-Phenoxybenzyl)oxy]phenyl}propanoic Acid (CID 51349861) is 3-[4-[(4-phenoxyphenyl)methoxy]phenyl]propanoic acid.
What is the SMILES notation for 3-{4-[(4-Phenoxybenzyl)oxy]phenyl}propanoic Acid?
The canonical SMILES for 3-{4-[(4-Phenoxybenzyl)oxy]phenyl}propanoic Acid is C1=CC=C(C=C1)OC2=CC=C(C=C2)COC3=CC=C(C=C3)CCC(=O)O.
What is the InChIKey of 3-{4-[(4-Phenoxybenzyl)oxy]phenyl}propanoic Acid?
The InChIKey is RJIGUHHUXAXYRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20O4/c23-22(24)15-10-17-6-11-19(12-7-17)25-16-18-8-13-21(14-9-18)26-20-4-2-1-3-5-20/h1-9,11-14H,10,15-16H2,(H,23,24).
What are the key properties of 3-{4-[(4-Phenoxybenzyl)oxy]phenyl}propanoic Acid?
3-{4-[(4-Phenoxybenzyl)oxy]phenyl}propanoic Acid has a molecular weight of 348.40 g/mol, XLogP of 4.70, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-{4-[(4-Phenoxybenzyl)oxy]phenyl}propanoic Acid is sourced from PubChem (CID 51349861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).