C21H17ClN2O4S — CID 51349974
4-[[1-(4-chlorophenyl)-1-hydroxy-3-oxoisoindol-2-yl]methyl]benzenesulfonamide (PubChem CID 51349974) has the molecular formula C21H17ClN2O4S and a molecular weight of 428.90 g/mol. Its IUPAC name is 4-[[1-(4-chlorophenyl)-1-hydroxy-3-oxoisoindol-2-yl]methyl]benzenesulfonamide.
| Compound Name | 4-[[1-(4-chlorophenyl)-1-hydroxy-3-oxoisoindol-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 51349974 |
| Molecular Formula | C21H17ClN2O4S |
| Molecular Weight | 428.90 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 4-[[1-(4-chlorophenyl)-1-hydroxy-3-oxoisoindol-2-yl]methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CN2C(=O)c3ccccc3C2(O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H17ClN2O4S/c22-16-9-7-15(8-10-16)21(26)19-4-2-1-3-18(19)20(25)24(21)13-14-5-11-17(12-6-14)29(23,27)28/h1-12,26H,13H2,(H2,23,27,28) |
| InChIKey | WFQKXJXPGWNYAI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.90 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |